C24H20FN5O4S — CID 43967700
N-(6-fluoro-1,3-benzothiazol-2-yl)-4-morpholin-4-yl-3-nitro-N-(pyridin-3-ylmethyl)benzamide (PubChem CID 43967700) has the molecular formula C24H20FN5O4S and a molecular weight of 493.52 g/mol. Its IUPAC name is N-(6-fluoro-1,3-benzothiazol-2-yl)-4-morpholin-4-yl-3-nitro-N-(pyridin-3-ylmethyl)benzamide.
| Compound Name | N-(6-fluoro-1,3-benzothiazol-2-yl)-4-morpholin-4-yl-3-nitro-N-(pyridin-3-ylmethyl)benzamide |
|---|---|
| PubChem CID | 43967700 |
| Molecular Formula | C24H20FN5O4S |
| Molecular Weight | 493.52 g/mol |
| Exact Mass | 493.12 |
| IUPAC Name | N-(6-fluoro-1,3-benzothiazol-2-yl)-4-morpholin-4-yl-3-nitro-N-(pyridin-3-ylmethyl)benzamide |
| SMILES | O=C(c1ccc(N2CCOCC2)c([N+](=O)[O-])c1)N(Cc1cccnc1)c1nc2ccc(F)cc2s1 |
| InChI | InChI=1S/C24H20FN5O4S/c25-18-4-5-19-22(13-18)35-24(27-19)29(15-16-2-1-7-26-14-16)23(31)17-3-6-20(21(12-17)30(32)33)28-8-10-34-11-9-28/h1-7,12-14H,8-11,15H2 |
| InChIKey | GGCKQLUJUSOVRO-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 101.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.52 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|