C27H27N5O4S — CID 43967483
N-(4-ethoxy-1,3-benzothiazol-2-yl)-3-nitro-4-piperidin-1-yl-N-(pyridin-3-ylmethyl)benzamide (PubChem CID 43967483) has the molecular formula C27H27N5O4S and a molecular weight of 517.61 g/mol. Its IUPAC name is N-(4-ethoxy-1,3-benzothiazol-2-yl)-3-nitro-4-piperidin-1-yl-N-(pyridin-3-ylmethyl)benzamide.
| Compound Name | N-(4-ethoxy-1,3-benzothiazol-2-yl)-3-nitro-4-piperidin-1-yl-N-(pyridin-3-ylmethyl)benzamide |
|---|---|
| PubChem CID | 43967483 |
| Molecular Formula | C27H27N5O4S |
| Molecular Weight | 517.61 g/mol |
| Exact Mass | 517.18 |
| IUPAC Name | N-(4-ethoxy-1,3-benzothiazol-2-yl)-3-nitro-4-piperidin-1-yl-N-(pyridin-3-ylmethyl)benzamide |
| SMILES | CCOc1cccc2sc(N(Cc3cccnc3)C(=O)c3ccc(N4CCCCC4)c([N+](=O)[O-])c3)nc12 |
| InChI | InChI=1S/C27H27N5O4S/c1-2-36-23-9-6-10-24-25(23)29-27(37-24)31(18-19-8-7-13-28-17-19)26(33)20-11-12-21(22(16-20)32(34)35)30-14-4-3-5-15-30/h6-13,16-17H,2-5,14-15,18H2,1H3 |
| InChIKey | PYLJCDSZNFZWPU-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 101.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.61 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|