C25H22ClN5O4S — CID 43968305
N-(6-chloro-4-methyl-1,3-benzothiazol-2-yl)-4-morpholin-4-yl-3-nitro-N-(pyridin-3-ylmethyl)benzamide (PubChem CID 43968305) has the molecular formula C25H22ClN5O4S and a molecular weight of 524.00 g/mol. Its IUPAC name is N-(6-chloro-4-methyl-1,3-benzothiazol-2-yl)-4-morpholin-4-yl-3-nitro-N-(pyridin-3-ylmethyl)benzamide.
| Compound Name | N-(6-chloro-4-methyl-1,3-benzothiazol-2-yl)-4-morpholin-4-yl-3-nitro-N-(pyridin-3-ylmethyl)benzamide |
|---|---|
| PubChem CID | 43968305 |
| Molecular Formula | C25H22ClN5O4S |
| Molecular Weight | 524.00 g/mol |
| Exact Mass | 523.11 |
| IUPAC Name | N-(6-chloro-4-methyl-1,3-benzothiazol-2-yl)-4-morpholin-4-yl-3-nitro-N-(pyridin-3-ylmethyl)benzamide |
| SMILES | Cc1cc(Cl)cc2sc(N(Cc3cccnc3)C(=O)c3ccc(N4CCOCC4)c([N+](=O)[O-])c3)nc12 |
| InChI | InChI=1S/C25H22ClN5O4S/c1-16-11-19(26)13-22-23(16)28-25(36-22)30(15-17-3-2-6-27-14-17)24(32)18-4-5-20(21(12-18)31(33)34)29-7-9-35-10-8-29/h2-6,11-14H,7-10,15H2,1H3 |
| InChIKey | FACMCJNYGHOJHT-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 101.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.00 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|