C23H26ClN5O4S — CID 43964975
N-(6-chloro-1,3-benzothiazol-2-yl)-N-[3-(dimethylamino)propyl]-4-morpholin-4-yl-3-nitrobenzamide (PubChem CID 43964975) has the molecular formula C23H26ClN5O4S and a molecular weight of 504.01 g/mol. Its IUPAC name is N-(6-chloro-1,3-benzothiazol-2-yl)-N-[3-(dimethylamino)propyl]-4-morpholin-4-yl-3-nitrobenzamide.
| Compound Name | N-(6-chloro-1,3-benzothiazol-2-yl)-N-[3-(dimethylamino)propyl]-4-morpholin-4-yl-3-nitrobenzamide |
|---|---|
| PubChem CID | 43964975 |
| Molecular Formula | C23H26ClN5O4S |
| Molecular Weight | 504.01 g/mol |
| Exact Mass | 503.14 |
| IUPAC Name | N-(6-chloro-1,3-benzothiazol-2-yl)-N-[3-(dimethylamino)propyl]-4-morpholin-4-yl-3-nitrobenzamide |
| SMILES | CN(C)CCCN(C(=O)c1ccc(N2CCOCC2)c([N+](=O)[O-])c1)c1nc2ccc(Cl)cc2s1 |
| InChI | InChI=1S/C23H26ClN5O4S/c1-26(2)8-3-9-28(23-25-18-6-5-17(24)15-21(18)34-23)22(30)16-4-7-19(20(14-16)29(31)32)27-10-12-33-13-11-27/h4-7,14-15H,3,8-13H2,1-2H3 |
| InChIKey | NVHVTICYPDDRRU-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 92.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.01 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|