C22H23F2N5O4S — CID 43962189
N-(4,6-difluoro-1,3-benzothiazol-2-yl)-N-[2-(dimethylamino)ethyl]-4-morpholin-4-yl-3-nitrobenzamide (PubChem CID 43962189) has the molecular formula C22H23F2N5O4S and a molecular weight of 491.52 g/mol. Its IUPAC name is N-(4,6-difluoro-1,3-benzothiazol-2-yl)-N-[2-(dimethylamino)ethyl]-4-morpholin-4-yl-3-nitrobenzamide.
| Compound Name | N-(4,6-difluoro-1,3-benzothiazol-2-yl)-N-[2-(dimethylamino)ethyl]-4-morpholin-4-yl-3-nitrobenzamide |
|---|---|
| PubChem CID | 43962189 |
| Molecular Formula | C22H23F2N5O4S |
| Molecular Weight | 491.52 g/mol |
| Exact Mass | 491.14 |
| IUPAC Name | N-(4,6-difluoro-1,3-benzothiazol-2-yl)-N-[2-(dimethylamino)ethyl]-4-morpholin-4-yl-3-nitrobenzamide |
| SMILES | CN(C)CCN(C(=O)c1ccc(N2CCOCC2)c([N+](=O)[O-])c1)c1nc2c(F)cc(F)cc2s1 |
| InChI | InChI=1S/C22H23F2N5O4S/c1-26(2)5-6-28(22-25-20-16(24)12-15(23)13-19(20)34-22)21(30)14-3-4-17(18(11-14)29(31)32)27-7-9-33-10-8-27/h3-4,11-13H,5-10H2,1-2H3 |
| InChIKey | BPHULHHEYAJXOA-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 92.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.52 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|