C26H31N5O6S — CID 43998339
N-(4-methoxy-7-methyl-1,3-benzothiazol-2-yl)-4-morpholin-4-yl-N-(2-morpholin-4-ylethyl)-3-nitrobenzamide (PubChem CID 43998339) has the molecular formula C26H31N5O6S and a molecular weight of 541.63 g/mol. Its IUPAC name is N-(4-methoxy-7-methyl-1,3-benzothiazol-2-yl)-4-morpholin-4-yl-N-(2-morpholin-4-ylethyl)-3-nitrobenzamide.
| Compound Name | N-(4-methoxy-7-methyl-1,3-benzothiazol-2-yl)-4-morpholin-4-yl-N-(2-morpholin-4-ylethyl)-3-nitrobenzamide |
|---|---|
| PubChem CID | 43998339 |
| Molecular Formula | C26H31N5O6S |
| Molecular Weight | 541.63 g/mol |
| Exact Mass | 541.20 |
| IUPAC Name | N-(4-methoxy-7-methyl-1,3-benzothiazol-2-yl)-4-morpholin-4-yl-N-(2-morpholin-4-ylethyl)-3-nitrobenzamide |
| SMILES | COc1ccc(C)c2sc(N(CCN3CCOCC3)C(=O)c3ccc(N4CCOCC4)c([N+](=O)[O-])c3)nc12 |
| InChI | InChI=1S/C26H31N5O6S/c1-18-3-6-22(35-2)23-24(18)38-26(27-23)30(8-7-28-9-13-36-14-10-28)25(32)19-4-5-20(21(17-19)31(33)34)29-11-15-37-16-12-29/h3-6,17H,7-16H2,1-2H3 |
| InChIKey | KMZHIFAQFRCFEL-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 110.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.63 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|