C27H33N5O4S — CID 43998254
N-(5,7-dimethyl-1,3-benzothiazol-2-yl)-N-(2-morpholin-4-ylethyl)-3-nitro-4-piperidin-1-ylbenzamide (PubChem CID 43998254) has the molecular formula C27H33N5O4S and a molecular weight of 523.66 g/mol. Its IUPAC name is N-(5,7-dimethyl-1,3-benzothiazol-2-yl)-N-(2-morpholin-4-ylethyl)-3-nitro-4-piperidin-1-ylbenzamide.
| Compound Name | N-(5,7-dimethyl-1,3-benzothiazol-2-yl)-N-(2-morpholin-4-ylethyl)-3-nitro-4-piperidin-1-ylbenzamide |
|---|---|
| PubChem CID | 43998254 |
| Molecular Formula | C27H33N5O4S |
| Molecular Weight | 523.66 g/mol |
| Exact Mass | 523.23 |
| IUPAC Name | N-(5,7-dimethyl-1,3-benzothiazol-2-yl)-N-(2-morpholin-4-ylethyl)-3-nitro-4-piperidin-1-ylbenzamide |
| SMILES | Cc1cc(C)c2sc(N(CCN3CCOCC3)C(=O)c3ccc(N4CCCCC4)c([N+](=O)[O-])c3)nc2c1 |
| InChI | InChI=1S/C27H33N5O4S/c1-19-16-20(2)25-22(17-19)28-27(37-25)31(11-10-29-12-14-36-15-13-29)26(33)21-6-7-23(24(18-21)32(34)35)30-8-4-3-5-9-30/h6-7,16-18H,3-5,8-15H2,1-2H3 |
| InChIKey | TUQGLACENSRSRL-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 92.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.66 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|