C25H31N5O3S — CID 43961783
N-(1,3-benzothiazol-2-yl)-N-[2-(diethylamino)ethyl]-3-nitro-4-piperidin-1-ylbenzamide (PubChem CID 43961783) has the molecular formula C25H31N5O3S and a molecular weight of 481.62 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-N-[2-(diethylamino)ethyl]-3-nitro-4-piperidin-1-ylbenzamide.
| Compound Name | N-(1,3-benzothiazol-2-yl)-N-[2-(diethylamino)ethyl]-3-nitro-4-piperidin-1-ylbenzamide |
|---|---|
| PubChem CID | 43961783 |
| Molecular Formula | C25H31N5O3S |
| Molecular Weight | 481.62 g/mol |
| Exact Mass | 481.21 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-N-[2-(diethylamino)ethyl]-3-nitro-4-piperidin-1-ylbenzamide |
| SMILES | CCN(CC)CCN(C(=O)c1ccc(N2CCCCC2)c([N+](=O)[O-])c1)c1nc2ccccc2s1 |
| InChI | InChI=1S/C25H31N5O3S/c1-3-27(4-2)16-17-29(25-26-20-10-6-7-11-23(20)34-25)24(31)19-12-13-21(22(18-19)30(32)33)28-14-8-5-9-15-28/h6-7,10-13,18H,3-5,8-9,14-17H2,1-2H3 |
| InChIKey | PQJIEVOAIQVIJU-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 82.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.62 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|