C26H25N5O4S — CID 43967618
N-(6-methoxy-1,3-benzothiazol-2-yl)-3-nitro-4-piperidin-1-yl-N-(pyridin-3-ylmethyl)benzamide (PubChem CID 43967618) has the molecular formula C26H25N5O4S and a molecular weight of 503.58 g/mol. Its IUPAC name is N-(6-methoxy-1,3-benzothiazol-2-yl)-3-nitro-4-piperidin-1-yl-N-(pyridin-3-ylmethyl)benzamide.
| Compound Name | N-(6-methoxy-1,3-benzothiazol-2-yl)-3-nitro-4-piperidin-1-yl-N-(pyridin-3-ylmethyl)benzamide |
|---|---|
| PubChem CID | 43967618 |
| Molecular Formula | C26H25N5O4S |
| Molecular Weight | 503.58 g/mol |
| Exact Mass | 503.16 |
| IUPAC Name | N-(6-methoxy-1,3-benzothiazol-2-yl)-3-nitro-4-piperidin-1-yl-N-(pyridin-3-ylmethyl)benzamide |
| SMILES | COc1ccc2nc(N(Cc3cccnc3)C(=O)c3ccc(N4CCCCC4)c([N+](=O)[O-])c3)sc2c1 |
| InChI | InChI=1S/C26H25N5O4S/c1-35-20-8-9-21-24(15-20)36-26(28-21)30(17-18-6-5-11-27-16-18)25(32)19-7-10-22(23(14-19)31(33)34)29-12-3-2-4-13-29/h5-11,14-16H,2-4,12-13,17H2,1H3 |
| InChIKey | JYRDWMQEXGMBBP-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 101.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.58 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|