C23H16N4O4S2 — CID 40982929
N-(6-methoxy-1,3-benzothiazol-2-yl)-5-nitro-N-(pyridin-3-ylmethyl)-1-benzothiophene-2-carboxamide (PubChem CID 40982929) has the molecular formula C23H16N4O4S2 and a molecular weight of 476.54 g/mol. Its IUPAC name is N-(6-methoxy-1,3-benzothiazol-2-yl)-5-nitro-N-(pyridin-3-ylmethyl)-1-benzothiophene-2-carboxamide.
| Compound Name | N-(6-methoxy-1,3-benzothiazol-2-yl)-5-nitro-N-(pyridin-3-ylmethyl)-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 40982929 |
| Molecular Formula | C23H16N4O4S2 |
| Molecular Weight | 476.54 g/mol |
| Exact Mass | 476.06 |
| IUPAC Name | N-(6-methoxy-1,3-benzothiazol-2-yl)-5-nitro-N-(pyridin-3-ylmethyl)-1-benzothiophene-2-carboxamide |
| SMILES | COc1ccc2nc(N(Cc3cccnc3)C(=O)c3cc4cc([N+](=O)[O-])ccc4s3)sc2c1 |
| InChI | InChI=1S/C23H16N4O4S2/c1-31-17-5-6-18-20(11-17)33-23(25-18)26(13-14-3-2-8-24-12-14)22(28)21-10-15-9-16(27(29)30)4-7-19(15)32-21/h2-12H,13H2,1H3 |
| InChIKey | YRDQXXTYOHMJMM-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 98.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.54 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|