C22H17N5O4S2 — CID 30461208
N-(6-methoxy-1,3-benzothiazol-2-yl)-5-nitro-N-(2-pyrazol-1-ylethyl)-1-benzothiophene-2-carboxamide (PubChem CID 30461208) has the molecular formula C22H17N5O4S2 and a molecular weight of 479.54 g/mol. Its IUPAC name is N-(6-methoxy-1,3-benzothiazol-2-yl)-5-nitro-N-(2-pyrazol-1-ylethyl)-1-benzothiophene-2-carboxamide.
| Compound Name | N-(6-methoxy-1,3-benzothiazol-2-yl)-5-nitro-N-(2-pyrazol-1-ylethyl)-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 30461208 |
| Molecular Formula | C22H17N5O4S2 |
| Molecular Weight | 479.54 g/mol |
| Exact Mass | 479.07 |
| IUPAC Name | N-(6-methoxy-1,3-benzothiazol-2-yl)-5-nitro-N-(2-pyrazol-1-ylethyl)-1-benzothiophene-2-carboxamide |
| SMILES | COc1ccc2nc(N(CCn3cccn3)C(=O)c3cc4cc([N+](=O)[O-])ccc4s3)sc2c1 |
| InChI | InChI=1S/C22H17N5O4S2/c1-31-16-4-5-17-19(13-16)33-22(24-17)26(10-9-25-8-2-7-23-25)21(28)20-12-14-11-15(27(29)30)3-6-18(14)32-20/h2-8,11-13H,9-10H2,1H3 |
| InChIKey | CQHYOLYOKCWBCD-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 103.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.54 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|