C19H14FN5O3S — CID 30461595
N-(6-fluoro-1,3-benzothiazol-2-yl)-3-nitro-N-(2-pyrazol-1-ylethyl)benzamide (PubChem CID 30461595) has the molecular formula C19H14FN5O3S and a molecular weight of 411.42 g/mol. Its IUPAC name is N-(6-fluoro-1,3-benzothiazol-2-yl)-3-nitro-N-(2-pyrazol-1-ylethyl)benzamide.
| Compound Name | N-(6-fluoro-1,3-benzothiazol-2-yl)-3-nitro-N-(2-pyrazol-1-ylethyl)benzamide |
|---|---|
| PubChem CID | 30461595 |
| Molecular Formula | C19H14FN5O3S |
| Molecular Weight | 411.42 g/mol |
| Exact Mass | 411.08 |
| IUPAC Name | N-(6-fluoro-1,3-benzothiazol-2-yl)-3-nitro-N-(2-pyrazol-1-ylethyl)benzamide |
| SMILES | O=C(c1cccc([N+](=O)[O-])c1)N(CCn1cccn1)c1nc2ccc(F)cc2s1 |
| InChI | InChI=1S/C19H14FN5O3S/c20-14-5-6-16-17(12-14)29-19(22-16)24(10-9-23-8-2-7-21-23)18(26)13-3-1-4-15(11-13)25(27)28/h1-8,11-12H,9-10H2 |
| InChIKey | YHDWPHYUEQUXCC-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 94.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.42 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|