C19H13FN6O5S — CID 30462589
N-(4-fluoro-1,3-benzothiazol-2-yl)-3,5-dinitro-N-(2-pyrazol-1-ylethyl)benzamide (PubChem CID 30462589) has the molecular formula C19H13FN6O5S and a molecular weight of 456.42 g/mol. Its IUPAC name is N-(4-fluoro-1,3-benzothiazol-2-yl)-3,5-dinitro-N-(2-pyrazol-1-ylethyl)benzamide.
| Compound Name | N-(4-fluoro-1,3-benzothiazol-2-yl)-3,5-dinitro-N-(2-pyrazol-1-ylethyl)benzamide |
|---|---|
| PubChem CID | 30462589 |
| Molecular Formula | C19H13FN6O5S |
| Molecular Weight | 456.42 g/mol |
| Exact Mass | 456.07 |
| IUPAC Name | N-(4-fluoro-1,3-benzothiazol-2-yl)-3,5-dinitro-N-(2-pyrazol-1-ylethyl)benzamide |
| SMILES | O=C(c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1)N(CCn1cccn1)c1nc2c(F)cccc2s1 |
| InChI | InChI=1S/C19H13FN6O5S/c20-15-3-1-4-16-17(15)22-19(32-16)24(8-7-23-6-2-5-21-23)18(27)12-9-13(25(28)29)11-14(10-12)26(30)31/h1-6,9-11H,7-8H2 |
| InChIKey | VMECBGFPJSVYBQ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 137.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.42 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|