C23H23FN4O2S — CID 30462535
4-butoxy-N-(4-fluoro-1,3-benzothiazol-2-yl)-N-(2-pyrazol-1-ylethyl)benzamide (PubChem CID 30462535) has the molecular formula C23H23FN4O2S and a molecular weight of 438.53 g/mol. Its IUPAC name is 4-butoxy-N-(4-fluoro-1,3-benzothiazol-2-yl)-N-(2-pyrazol-1-ylethyl)benzamide.
| Compound Name | 4-butoxy-N-(4-fluoro-1,3-benzothiazol-2-yl)-N-(2-pyrazol-1-ylethyl)benzamide |
|---|---|
| PubChem CID | 30462535 |
| Molecular Formula | C23H23FN4O2S |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.15 |
| IUPAC Name | 4-butoxy-N-(4-fluoro-1,3-benzothiazol-2-yl)-N-(2-pyrazol-1-ylethyl)benzamide |
| SMILES | CCCCOc1ccc(C(=O)N(CCn2cccn2)c2nc3c(F)cccc3s2)cc1 |
| InChI | InChI=1S/C23H23FN4O2S/c1-2-3-16-30-18-10-8-17(9-11-18)22(29)28(15-14-27-13-5-12-25-27)23-26-21-19(24)6-4-7-20(21)31-23/h4-13H,2-3,14-16H2,1H3 |
| InChIKey | BZMSOJIQLIXTTA-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|