C23H24N4O2S — CID 30460212
N-(1,3-benzothiazol-2-yl)-4-butoxy-N-(2-pyrazol-1-ylethyl)benzamide (PubChem CID 30460212) has the molecular formula C23H24N4O2S and a molecular weight of 420.54 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-4-butoxy-N-(2-pyrazol-1-ylethyl)benzamide.
| Compound Name | N-(1,3-benzothiazol-2-yl)-4-butoxy-N-(2-pyrazol-1-ylethyl)benzamide |
|---|---|
| PubChem CID | 30460212 |
| Molecular Formula | C23H24N4O2S |
| Molecular Weight | 420.54 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-4-butoxy-N-(2-pyrazol-1-ylethyl)benzamide |
| SMILES | CCCCOc1ccc(C(=O)N(CCn2cccn2)c2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C23H24N4O2S/c1-2-3-17-29-19-11-9-18(10-12-19)22(28)27(16-15-26-14-6-13-24-26)23-25-20-7-4-5-8-21(20)30-23/h4-14H,2-3,15-17H2,1H3 |
| InChIKey | SJPKRZXIOFIKSN-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.54 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|