C24H25ClN4O2S — CID 30460774
N-(4-chloro-1,3-benzothiazol-2-yl)-4-pentoxy-N-(2-pyrazol-1-ylethyl)benzamide (PubChem CID 30460774) has the molecular formula C24H25ClN4O2S and a molecular weight of 469.01 g/mol. Its IUPAC name is N-(4-chloro-1,3-benzothiazol-2-yl)-4-pentoxy-N-(2-pyrazol-1-ylethyl)benzamide.
| Compound Name | N-(4-chloro-1,3-benzothiazol-2-yl)-4-pentoxy-N-(2-pyrazol-1-ylethyl)benzamide |
|---|---|
| PubChem CID | 30460774 |
| Molecular Formula | C24H25ClN4O2S |
| Molecular Weight | 469.01 g/mol |
| Exact Mass | 468.14 |
| IUPAC Name | N-(4-chloro-1,3-benzothiazol-2-yl)-4-pentoxy-N-(2-pyrazol-1-ylethyl)benzamide |
| SMILES | CCCCCOc1ccc(C(=O)N(CCn2cccn2)c2nc3c(Cl)cccc3s2)cc1 |
| InChI | InChI=1S/C24H25ClN4O2S/c1-2-3-4-17-31-19-11-9-18(10-12-19)23(30)29(16-15-28-14-6-13-26-28)24-27-22-20(25)7-5-8-21(22)32-24/h5-14H,2-4,15-17H2,1H3 |
| InChIKey | IANGDPCJMJYFPA-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.01 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|