C25H30FN3O3S — CID 29137716
N-(4-fluoro-1,3-benzothiazol-2-yl)-N-(2-morpholin-4-ylethyl)-4-pentoxybenzamide (PubChem CID 29137716) has the molecular formula C25H30FN3O3S and a molecular weight of 471.60 g/mol. Its IUPAC name is N-(4-fluoro-1,3-benzothiazol-2-yl)-N-(2-morpholin-4-ylethyl)-4-pentoxybenzamide.
| Compound Name | N-(4-fluoro-1,3-benzothiazol-2-yl)-N-(2-morpholin-4-ylethyl)-4-pentoxybenzamide |
|---|---|
| PubChem CID | 29137716 |
| Molecular Formula | C25H30FN3O3S |
| Molecular Weight | 471.60 g/mol |
| Exact Mass | 471.20 |
| IUPAC Name | N-(4-fluoro-1,3-benzothiazol-2-yl)-N-(2-morpholin-4-ylethyl)-4-pentoxybenzamide |
| SMILES | CCCCCOc1ccc(C(=O)N(CCN2CCOCC2)c2nc3c(F)cccc3s2)cc1 |
| InChI | InChI=1S/C25H30FN3O3S/c1-2-3-4-16-32-20-10-8-19(9-11-20)24(30)29(13-12-28-14-17-31-18-15-28)25-27-23-21(26)6-5-7-22(23)33-25/h5-11H,2-4,12-18H2,1H3 |
| InChIKey | PTBCUKMIKRPREB-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 54.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.60 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|