C20H13FN4O3S — CID 16804307
N-(4-fluoro-1,3-benzothiazol-2-yl)-4-nitro-N-(pyridin-4-ylmethyl)benzamide (PubChem CID 16804307) has the molecular formula C20H13FN4O3S and a molecular weight of 408.41 g/mol. Its IUPAC name is N-(4-fluoro-1,3-benzothiazol-2-yl)-4-nitro-N-(pyridin-4-ylmethyl)benzamide.
| Compound Name | N-(4-fluoro-1,3-benzothiazol-2-yl)-4-nitro-N-(pyridin-4-ylmethyl)benzamide |
|---|---|
| PubChem CID | 16804307 |
| Molecular Formula | C20H13FN4O3S |
| Molecular Weight | 408.41 g/mol |
| Exact Mass | 408.07 |
| IUPAC Name | N-(4-fluoro-1,3-benzothiazol-2-yl)-4-nitro-N-(pyridin-4-ylmethyl)benzamide |
| SMILES | O=C(c1ccc([N+](=O)[O-])cc1)N(Cc1ccncc1)c1nc2c(F)cccc2s1 |
| InChI | InChI=1S/C20H13FN4O3S/c21-16-2-1-3-17-18(16)23-20(29-17)24(12-13-8-10-22-11-9-13)19(26)14-4-6-15(7-5-14)25(27)28/h1-11H,12H2 |
| InChIKey | NKKUDEKKEWIZLA-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 89.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.41 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|