C21H14FN3O3S — CID 8670812
N-benzyl-N-(4-fluoro-1,3-benzothiazol-2-yl)-4-nitrobenzamide (PubChem CID 8670812) has the molecular formula C21H14FN3O3S and a molecular weight of 407.43 g/mol. Its IUPAC name is N-benzyl-N-(4-fluoro-1,3-benzothiazol-2-yl)-4-nitrobenzamide.
| Compound Name | N-benzyl-N-(4-fluoro-1,3-benzothiazol-2-yl)-4-nitrobenzamide |
|---|---|
| PubChem CID | 8670812 |
| Molecular Formula | C21H14FN3O3S |
| Molecular Weight | 407.43 g/mol |
| Exact Mass | 407.07 |
| IUPAC Name | N-benzyl-N-(4-fluoro-1,3-benzothiazol-2-yl)-4-nitrobenzamide |
| SMILES | O=C(c1ccc([N+](=O)[O-])cc1)N(Cc1ccccc1)c1nc2c(F)cccc2s1 |
| InChI | InChI=1S/C21H14FN3O3S/c22-17-7-4-8-18-19(17)23-21(29-18)24(13-14-5-2-1-3-6-14)20(26)15-9-11-16(12-10-15)25(27)28/h1-12H,13H2 |
| InChIKey | XMGUSCGZSMGYAH-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 76.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.43 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|