C22H17FN2OS — CID 41109949
N-benzyl-N-(4-fluoro-1,3-benzothiazol-2-yl)-2-phenylacetamide (PubChem CID 41109949) has the molecular formula C22H17FN2OS and a molecular weight of 376.46 g/mol. Its IUPAC name is N-benzyl-N-(4-fluoro-1,3-benzothiazol-2-yl)-2-phenylacetamide.
| Compound Name | N-benzyl-N-(4-fluoro-1,3-benzothiazol-2-yl)-2-phenylacetamide |
|---|---|
| PubChem CID | 41109949 |
| Molecular Formula | C22H17FN2OS |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | N-benzyl-N-(4-fluoro-1,3-benzothiazol-2-yl)-2-phenylacetamide |
| SMILES | O=C(Cc1ccccc1)N(Cc1ccccc1)c1nc2c(F)cccc2s1 |
| InChI | InChI=1S/C22H17FN2OS/c23-18-12-7-13-19-21(18)24-22(27-19)25(15-17-10-5-2-6-11-17)20(26)14-16-8-3-1-4-9-16/h1-13H,14-15H2 |
| InChIKey | UYWNJUDSEXLGNN-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |