C24H20N4O5S — CID 16841720
N-benzyl-3,5-dinitro-N-(4-propan-2-yl-1,3-benzothiazol-2-yl)benzamide (PubChem CID 16841720) has the molecular formula C24H20N4O5S and a molecular weight of 476.51 g/mol. Its IUPAC name is N-benzyl-3,5-dinitro-N-(4-propan-2-yl-1,3-benzothiazol-2-yl)benzamide.
| Compound Name | N-benzyl-3,5-dinitro-N-(4-propan-2-yl-1,3-benzothiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 16841720 |
| Molecular Formula | C24H20N4O5S |
| Molecular Weight | 476.51 g/mol |
| Exact Mass | 476.12 |
| IUPAC Name | N-benzyl-3,5-dinitro-N-(4-propan-2-yl-1,3-benzothiazol-2-yl)benzamide |
| SMILES | CC(C)c1cccc2sc(N(Cc3ccccc3)C(=O)c3cc([N+](=O)[O-])cc([N+](=O)[O-])c3)nc12 |
| InChI | InChI=1S/C24H20N4O5S/c1-15(2)20-9-6-10-21-22(20)25-24(34-21)26(14-16-7-4-3-5-8-16)23(29)17-11-18(27(30)31)13-19(12-17)28(32)33/h3-13,15H,14H2,1-2H3 |
| InChIKey | KWQGQOFVGGDXTK-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 119.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.51 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|