C22H16N4O5S — CID 41110107
N-benzyl-N-(6-methyl-1,3-benzothiazol-2-yl)-3,5-dinitrobenzamide (PubChem CID 41110107) has the molecular formula C22H16N4O5S and a molecular weight of 448.46 g/mol. Its IUPAC name is N-benzyl-N-(6-methyl-1,3-benzothiazol-2-yl)-3,5-dinitrobenzamide.
| Compound Name | N-benzyl-N-(6-methyl-1,3-benzothiazol-2-yl)-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 41110107 |
| Molecular Formula | C22H16N4O5S |
| Molecular Weight | 448.46 g/mol |
| Exact Mass | 448.08 |
| IUPAC Name | N-benzyl-N-(6-methyl-1,3-benzothiazol-2-yl)-3,5-dinitrobenzamide |
| SMILES | Cc1ccc2nc(N(Cc3ccccc3)C(=O)c3cc([N+](=O)[O-])cc([N+](=O)[O-])c3)sc2c1 |
| InChI | InChI=1S/C22H16N4O5S/c1-14-7-8-19-20(9-14)32-22(23-19)24(13-15-5-3-2-4-6-15)21(27)16-10-17(25(28)29)12-18(11-16)26(30)31/h2-12H,13H2,1H3 |
| InChIKey | IETGADVCPIWGLW-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 119.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.46 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|