C28H30N2O2S — CID 43989919
N-benzyl-3-butoxy-N-(4-propan-2-yl-1,3-benzothiazol-2-yl)benzamide (PubChem CID 43989919) has the molecular formula C28H30N2O2S and a molecular weight of 458.63 g/mol. Its IUPAC name is N-benzyl-3-butoxy-N-(4-propan-2-yl-1,3-benzothiazol-2-yl)benzamide.
| Compound Name | N-benzyl-3-butoxy-N-(4-propan-2-yl-1,3-benzothiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 43989919 |
| Molecular Formula | C28H30N2O2S |
| Molecular Weight | 458.63 g/mol |
| Exact Mass | 458.20 |
| IUPAC Name | N-benzyl-3-butoxy-N-(4-propan-2-yl-1,3-benzothiazol-2-yl)benzamide |
| SMILES | CCCCOc1cccc(C(=O)N(Cc2ccccc2)c2nc3c(C(C)C)cccc3s2)c1 |
| InChI | InChI=1S/C28H30N2O2S/c1-4-5-17-32-23-14-9-13-22(18-23)27(31)30(19-21-11-7-6-8-12-21)28-29-26-24(20(2)3)15-10-16-25(26)33-28/h6-16,18,20H,4-5,17,19H2,1-3H3 |
| InChIKey | CSRCPOQIZMRJMM-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.63 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|