C26H32N2O3S — CID 43989819
3-butoxy-N-(oxolan-2-ylmethyl)-N-(4-propan-2-yl-1,3-benzothiazol-2-yl)benzamide (PubChem CID 43989819) has the molecular formula C26H32N2O3S and a molecular weight of 452.62 g/mol. Its IUPAC name is 3-butoxy-N-(oxolan-2-ylmethyl)-N-(4-propan-2-yl-1,3-benzothiazol-2-yl)benzamide.
| Compound Name | 3-butoxy-N-(oxolan-2-ylmethyl)-N-(4-propan-2-yl-1,3-benzothiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 43989819 |
| Molecular Formula | C26H32N2O3S |
| Molecular Weight | 452.62 g/mol |
| Exact Mass | 452.21 |
| IUPAC Name | 3-butoxy-N-(oxolan-2-ylmethyl)-N-(4-propan-2-yl-1,3-benzothiazol-2-yl)benzamide |
| SMILES | CCCCOc1cccc(C(=O)N(CC2CCCO2)c2nc3c(C(C)C)cccc3s2)c1 |
| InChI | InChI=1S/C26H32N2O3S/c1-4-5-14-30-20-10-6-9-19(16-20)25(29)28(17-21-11-8-15-31-21)26-27-24-22(18(2)3)12-7-13-23(24)32-26/h6-7,9-10,12-13,16,18,21H,4-5,8,11,14-15,17H2,1-3H3 |
| InChIKey | NQEYYNXFMAYUCN-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.62 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|