C27H29N3O2S — CID 43987656
3-butoxy-N-(4-propan-2-yl-1,3-benzothiazol-2-yl)-N-(pyridin-2-ylmethyl)benzamide (PubChem CID 43987656) has the molecular formula C27H29N3O2S and a molecular weight of 459.62 g/mol. Its IUPAC name is 3-butoxy-N-(4-propan-2-yl-1,3-benzothiazol-2-yl)-N-(pyridin-2-ylmethyl)benzamide.
| Compound Name | 3-butoxy-N-(4-propan-2-yl-1,3-benzothiazol-2-yl)-N-(pyridin-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 43987656 |
| Molecular Formula | C27H29N3O2S |
| Molecular Weight | 459.62 g/mol |
| Exact Mass | 459.20 |
| IUPAC Name | 3-butoxy-N-(4-propan-2-yl-1,3-benzothiazol-2-yl)-N-(pyridin-2-ylmethyl)benzamide |
| SMILES | CCCCOc1cccc(C(=O)N(Cc2ccccn2)c2nc3c(C(C)C)cccc3s2)c1 |
| InChI | InChI=1S/C27H29N3O2S/c1-4-5-16-32-22-12-8-10-20(17-22)26(31)30(18-21-11-6-7-15-28-21)27-29-25-23(19(2)3)13-9-14-24(25)33-27/h6-15,17,19H,4-5,16,18H2,1-3H3 |
| InChIKey | IUNHAXRWQIVHJS-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.62 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|