C25H25N3O2S — CID 41055313
4-butoxy-N-(4-methyl-1,3-benzothiazol-2-yl)-N-(pyridin-2-ylmethyl)benzamide (PubChem CID 41055313) has the molecular formula C25H25N3O2S and a molecular weight of 431.56 g/mol. Its IUPAC name is 4-butoxy-N-(4-methyl-1,3-benzothiazol-2-yl)-N-(pyridin-2-ylmethyl)benzamide.
| Compound Name | 4-butoxy-N-(4-methyl-1,3-benzothiazol-2-yl)-N-(pyridin-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 41055313 |
| Molecular Formula | C25H25N3O2S |
| Molecular Weight | 431.56 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | 4-butoxy-N-(4-methyl-1,3-benzothiazol-2-yl)-N-(pyridin-2-ylmethyl)benzamide |
| SMILES | CCCCOc1ccc(C(=O)N(Cc2ccccn2)c2nc3c(C)cccc3s2)cc1 |
| InChI | InChI=1S/C25H25N3O2S/c1-3-4-16-30-21-13-11-19(12-14-21)24(29)28(17-20-9-5-6-15-26-20)25-27-23-18(2)8-7-10-22(23)31-25/h5-15H,3-4,16-17H2,1-2H3 |
| InChIKey | KLLPTUSZLROAQD-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.56 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|