C26H27N3O4S — CID 41056401
3-butoxy-N-(4,7-dimethoxy-1,3-benzothiazol-2-yl)-N-(pyridin-2-ylmethyl)benzamide (PubChem CID 41056401) has the molecular formula C26H27N3O4S and a molecular weight of 477.59 g/mol. Its IUPAC name is 3-butoxy-N-(4,7-dimethoxy-1,3-benzothiazol-2-yl)-N-(pyridin-2-ylmethyl)benzamide.
| Compound Name | 3-butoxy-N-(4,7-dimethoxy-1,3-benzothiazol-2-yl)-N-(pyridin-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 41056401 |
| Molecular Formula | C26H27N3O4S |
| Molecular Weight | 477.59 g/mol |
| Exact Mass | 477.17 |
| IUPAC Name | 3-butoxy-N-(4,7-dimethoxy-1,3-benzothiazol-2-yl)-N-(pyridin-2-ylmethyl)benzamide |
| SMILES | CCCCOc1cccc(C(=O)N(Cc2ccccn2)c2nc3c(OC)ccc(OC)c3s2)c1 |
| InChI | InChI=1S/C26H27N3O4S/c1-4-5-15-33-20-11-8-9-18(16-20)25(30)29(17-19-10-6-7-14-27-19)26-28-23-21(31-2)12-13-22(32-3)24(23)34-26/h6-14,16H,4-5,15,17H2,1-3H3 |
| InChIKey | SXYRPKOORYDBCY-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 73.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.59 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|