C24H30ClN3O3S — CID 43995045
3-butoxy-N-(7-chloro-4-methoxy-1,3-benzothiazol-2-yl)-N-[3-(dimethylamino)propyl]benzamide (PubChem CID 43995045) has the molecular formula C24H30ClN3O3S and a molecular weight of 476.04 g/mol. Its IUPAC name is 3-butoxy-N-(7-chloro-4-methoxy-1,3-benzothiazol-2-yl)-N-[3-(dimethylamino)propyl]benzamide.
| Compound Name | 3-butoxy-N-(7-chloro-4-methoxy-1,3-benzothiazol-2-yl)-N-[3-(dimethylamino)propyl]benzamide |
|---|---|
| PubChem CID | 43995045 |
| Molecular Formula | C24H30ClN3O3S |
| Molecular Weight | 476.04 g/mol |
| Exact Mass | 475.17 |
| IUPAC Name | 3-butoxy-N-(7-chloro-4-methoxy-1,3-benzothiazol-2-yl)-N-[3-(dimethylamino)propyl]benzamide |
| SMILES | CCCCOc1cccc(C(=O)N(CCCN(C)C)c2nc3c(OC)ccc(Cl)c3s2)c1 |
| InChI | InChI=1S/C24H30ClN3O3S/c1-5-6-15-31-18-10-7-9-17(16-18)23(29)28(14-8-13-27(2)3)24-26-21-20(30-4)12-11-19(25)22(21)32-24/h7,9-12,16H,5-6,8,13-15H2,1-4H3 |
| InChIKey | WLPFBJMZCHXBCX-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 54.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.04 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|