C23H28ClN3O3S — CID 41076018
4-butoxy-N-(7-chloro-4-methoxy-1,3-benzothiazol-2-yl)-N-[2-(dimethylamino)ethyl]benzamide (PubChem CID 41076018) has the molecular formula C23H28ClN3O3S and a molecular weight of 462.02 g/mol. Its IUPAC name is 4-butoxy-N-(7-chloro-4-methoxy-1,3-benzothiazol-2-yl)-N-[2-(dimethylamino)ethyl]benzamide.
| Compound Name | 4-butoxy-N-(7-chloro-4-methoxy-1,3-benzothiazol-2-yl)-N-[2-(dimethylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 41076018 |
| Molecular Formula | C23H28ClN3O3S |
| Molecular Weight | 462.02 g/mol |
| Exact Mass | 461.15 |
| IUPAC Name | 4-butoxy-N-(7-chloro-4-methoxy-1,3-benzothiazol-2-yl)-N-[2-(dimethylamino)ethyl]benzamide |
| SMILES | CCCCOc1ccc(C(=O)N(CCN(C)C)c2nc3c(OC)ccc(Cl)c3s2)cc1 |
| InChI | InChI=1S/C23H28ClN3O3S/c1-5-6-15-30-17-9-7-16(8-10-17)22(28)27(14-13-26(2)3)23-25-20-19(29-4)12-11-18(24)21(20)31-23/h7-12H,5-6,13-15H2,1-4H3 |
| InChIKey | GMWUSAMIOIUWJK-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 54.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.02 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|