C25H33N3O2S — CID 43964256
3-butoxy-N-[3-(dimethylamino)propyl]-N-(5,7-dimethyl-1,3-benzothiazol-2-yl)benzamide (PubChem CID 43964256) has the molecular formula C25H33N3O2S and a molecular weight of 439.63 g/mol. Its IUPAC name is 3-butoxy-N-[3-(dimethylamino)propyl]-N-(5,7-dimethyl-1,3-benzothiazol-2-yl)benzamide.
| Compound Name | 3-butoxy-N-[3-(dimethylamino)propyl]-N-(5,7-dimethyl-1,3-benzothiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 43964256 |
| Molecular Formula | C25H33N3O2S |
| Molecular Weight | 439.63 g/mol |
| Exact Mass | 439.23 |
| IUPAC Name | 3-butoxy-N-[3-(dimethylamino)propyl]-N-(5,7-dimethyl-1,3-benzothiazol-2-yl)benzamide |
| SMILES | CCCCOc1cccc(C(=O)N(CCCN(C)C)c2nc3cc(C)cc(C)c3s2)c1 |
| InChI | InChI=1S/C25H33N3O2S/c1-6-7-14-30-21-11-8-10-20(17-21)24(29)28(13-9-12-27(4)5)25-26-22-16-18(2)15-19(3)23(22)31-25/h8,10-11,15-17H,6-7,9,12-14H2,1-5H3 |
| InChIKey | XJMCXWRMYGOBKS-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.63 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|