C28H31N3O2S — CID 43965774
4-pentoxy-N-(4-propan-2-yl-1,3-benzothiazol-2-yl)-N-(pyridin-3-ylmethyl)benzamide (PubChem CID 43965774) has the molecular formula C28H31N3O2S and a molecular weight of 473.64 g/mol. Its IUPAC name is 4-pentoxy-N-(4-propan-2-yl-1,3-benzothiazol-2-yl)-N-(pyridin-3-ylmethyl)benzamide.
| Compound Name | 4-pentoxy-N-(4-propan-2-yl-1,3-benzothiazol-2-yl)-N-(pyridin-3-ylmethyl)benzamide |
|---|---|
| PubChem CID | 43965774 |
| Molecular Formula | C28H31N3O2S |
| Molecular Weight | 473.64 g/mol |
| Exact Mass | 473.21 |
| IUPAC Name | 4-pentoxy-N-(4-propan-2-yl-1,3-benzothiazol-2-yl)-N-(pyridin-3-ylmethyl)benzamide |
| SMILES | CCCCCOc1ccc(C(=O)N(Cc2cccnc2)c2nc3c(C(C)C)cccc3s2)cc1 |
| InChI | InChI=1S/C28H31N3O2S/c1-4-5-6-17-33-23-14-12-22(13-15-23)27(32)31(19-21-9-8-16-29-18-21)28-30-26-24(20(2)3)10-7-11-25(26)34-28/h7-16,18,20H,4-6,17,19H2,1-3H3 |
| InChIKey | ARQCGACKYMHVJH-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.64 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|