C24H22FN3O2S — CID 40983059
4-butoxy-N-(6-fluoro-1,3-benzothiazol-2-yl)-N-(pyridin-3-ylmethyl)benzamide (PubChem CID 40983059) has the molecular formula C24H22FN3O2S and a molecular weight of 435.52 g/mol. Its IUPAC name is 4-butoxy-N-(6-fluoro-1,3-benzothiazol-2-yl)-N-(pyridin-3-ylmethyl)benzamide.
| Compound Name | 4-butoxy-N-(6-fluoro-1,3-benzothiazol-2-yl)-N-(pyridin-3-ylmethyl)benzamide |
|---|---|
| PubChem CID | 40983059 |
| Molecular Formula | C24H22FN3O2S |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.14 |
| IUPAC Name | 4-butoxy-N-(6-fluoro-1,3-benzothiazol-2-yl)-N-(pyridin-3-ylmethyl)benzamide |
| SMILES | CCCCOc1ccc(C(=O)N(Cc2cccnc2)c2nc3ccc(F)cc3s2)cc1 |
| InChI | InChI=1S/C24H22FN3O2S/c1-2-3-13-30-20-9-6-18(7-10-20)23(29)28(16-17-5-4-12-26-15-17)24-27-21-11-8-19(25)14-22(21)31-24/h4-12,14-15H,2-3,13,16H2,1H3 |
| InChIKey | KMHLQYOGHUHCDU-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|