C26H27N3O3S — CID 40983448
3-butoxy-N-(4-ethoxy-1,3-benzothiazol-2-yl)-N-(pyridin-3-ylmethyl)benzamide (PubChem CID 40983448) has the molecular formula C26H27N3O3S and a molecular weight of 461.59 g/mol. Its IUPAC name is 3-butoxy-N-(4-ethoxy-1,3-benzothiazol-2-yl)-N-(pyridin-3-ylmethyl)benzamide.
| Compound Name | 3-butoxy-N-(4-ethoxy-1,3-benzothiazol-2-yl)-N-(pyridin-3-ylmethyl)benzamide |
|---|---|
| PubChem CID | 40983448 |
| Molecular Formula | C26H27N3O3S |
| Molecular Weight | 461.59 g/mol |
| Exact Mass | 461.18 |
| IUPAC Name | 3-butoxy-N-(4-ethoxy-1,3-benzothiazol-2-yl)-N-(pyridin-3-ylmethyl)benzamide |
| SMILES | CCCCOc1cccc(C(=O)N(Cc2cccnc2)c2nc3c(OCC)cccc3s2)c1 |
| InChI | InChI=1S/C26H27N3O3S/c1-3-5-15-32-21-11-6-10-20(16-21)25(30)29(18-19-9-8-14-27-17-19)26-28-24-22(31-4-2)12-7-13-23(24)33-26/h6-14,16-17H,3-5,15,18H2,1-2H3 |
| InChIKey | MBZMYCFCLGSTLE-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.59 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|