C19H21ClN4O3S2 — CID 44946326
N-[2-(dimethylamino)ethyl]-N-(4-methylsulfanyl-1,3-benzothiazol-2-yl)-4-nitrobenzamide;hydrochloride (PubChem CID 44946326) has the molecular formula C19H21ClN4O3S2 and a molecular weight of 452.99 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-N-(4-methylsulfanyl-1,3-benzothiazol-2-yl)-4-nitrobenzamide;hydrochloride.
| Compound Name | N-[2-(dimethylamino)ethyl]-N-(4-methylsulfanyl-1,3-benzothiazol-2-yl)-4-nitrobenzamide;hydrochloride |
|---|---|
| PubChem CID | 44946326 |
| Molecular Formula | C19H21ClN4O3S2 |
| Molecular Weight | 452.99 g/mol |
| Exact Mass | 452.07 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-N-(4-methylsulfanyl-1,3-benzothiazol-2-yl)-4-nitrobenzamide;hydrochloride |
| SMILES | CSc1cccc2sc(N(CCN(C)C)C(=O)c3ccc([N+](=O)[O-])cc3)nc12.Cl |
| InChI | InChI=1S/C19H20N4O3S2.ClH/c1-21(2)11-12-22(18(24)13-7-9-14(10-8-13)23(25)26)19-20-17-15(27-3)5-4-6-16(17)28-19;/h4-10H,11-12H2,1-3H3;1H |
| InChIKey | DRQOGLDACOSNJD-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 79.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.99 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|