C21H19FN4O3S2 — CID 41347084
N-[3-(dimethylamino)propyl]-N-(6-fluoro-1,3-benzothiazol-2-yl)-5-nitro-1-benzothiophene-2-carboxamide (PubChem CID 41347084) has the molecular formula C21H19FN4O3S2 and a molecular weight of 458.54 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-N-(6-fluoro-1,3-benzothiazol-2-yl)-5-nitro-1-benzothiophene-2-carboxamide.
| Compound Name | N-[3-(dimethylamino)propyl]-N-(6-fluoro-1,3-benzothiazol-2-yl)-5-nitro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 41347084 |
| Molecular Formula | C21H19FN4O3S2 |
| Molecular Weight | 458.54 g/mol |
| Exact Mass | 458.09 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-N-(6-fluoro-1,3-benzothiazol-2-yl)-5-nitro-1-benzothiophene-2-carboxamide |
| SMILES | CN(C)CCCN(C(=O)c1cc2cc([N+](=O)[O-])ccc2s1)c1nc2ccc(F)cc2s1 |
| InChI | InChI=1S/C21H19FN4O3S2/c1-24(2)8-3-9-25(21-23-16-6-4-14(22)12-18(16)31-21)20(27)19-11-13-10-15(26(28)29)5-7-17(13)30-19/h4-7,10-12H,3,8-9H2,1-2H3 |
| InChIKey | RXXWZLNCYCDNOQ-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 79.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.54 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|