C22H21ClN4O4S2 — CID 41076648
N-(7-chloro-4-methoxy-1,3-benzothiazol-2-yl)-N-[3-(dimethylamino)propyl]-5-nitro-1-benzothiophene-2-carboxamide (PubChem CID 41076648) has the molecular formula C22H21ClN4O4S2 and a molecular weight of 505.02 g/mol. Its IUPAC name is N-(7-chloro-4-methoxy-1,3-benzothiazol-2-yl)-N-[3-(dimethylamino)propyl]-5-nitro-1-benzothiophene-2-carboxamide.
| Compound Name | N-(7-chloro-4-methoxy-1,3-benzothiazol-2-yl)-N-[3-(dimethylamino)propyl]-5-nitro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 41076648 |
| Molecular Formula | C22H21ClN4O4S2 |
| Molecular Weight | 505.02 g/mol |
| Exact Mass | 504.07 |
| IUPAC Name | N-(7-chloro-4-methoxy-1,3-benzothiazol-2-yl)-N-[3-(dimethylamino)propyl]-5-nitro-1-benzothiophene-2-carboxamide |
| SMILES | COc1ccc(Cl)c2sc(N(CCCN(C)C)C(=O)c3cc4cc([N+](=O)[O-])ccc4s3)nc12 |
| InChI | InChI=1S/C22H21ClN4O4S2/c1-25(2)9-4-10-26(22-24-19-16(31-3)7-6-15(23)20(19)33-22)21(28)18-12-13-11-14(27(29)30)5-8-17(13)32-18/h5-8,11-12H,4,9-10H2,1-3H3 |
| InChIKey | VKVDKNUSINORME-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 88.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.02 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|