C22H23ClN4O3S2 — CID 44923471
N-[2-(dimethylamino)ethyl]-N-(6-ethyl-1,3-benzothiazol-2-yl)-5-nitro-1-benzothiophene-2-carboxamide;hydrochloride (PubChem CID 44923471) has the molecular formula C22H23ClN4O3S2 and a molecular weight of 491.04 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-N-(6-ethyl-1,3-benzothiazol-2-yl)-5-nitro-1-benzothiophene-2-carboxamide;hydrochloride.
| Compound Name | N-[2-(dimethylamino)ethyl]-N-(6-ethyl-1,3-benzothiazol-2-yl)-5-nitro-1-benzothiophene-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 44923471 |
| Molecular Formula | C22H23ClN4O3S2 |
| Molecular Weight | 491.04 g/mol |
| Exact Mass | 490.09 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-N-(6-ethyl-1,3-benzothiazol-2-yl)-5-nitro-1-benzothiophene-2-carboxamide;hydrochloride |
| SMILES | CCc1ccc2nc(N(CCN(C)C)C(=O)c3cc4cc([N+](=O)[O-])ccc4s3)sc2c1.Cl |
| InChI | InChI=1S/C22H22N4O3S2.ClH/c1-4-14-5-7-17-19(11-14)31-22(23-17)25(10-9-24(2)3)21(27)20-13-15-12-16(26(28)29)6-8-18(15)30-20;/h5-8,11-13H,4,9-10H2,1-3H3;1H |
| InChIKey | LBJPVRSJPHLNAQ-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 79.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.04 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|