C24H24N4O4S2 — CID 29070314
N-(6-methyl-1,3-benzothiazol-2-yl)-N-(3-morpholin-4-ylpropyl)-5-nitro-1-benzothiophene-2-carboxamide (PubChem CID 29070314) has the molecular formula C24H24N4O4S2 and a molecular weight of 496.61 g/mol. Its IUPAC name is N-(6-methyl-1,3-benzothiazol-2-yl)-N-(3-morpholin-4-ylpropyl)-5-nitro-1-benzothiophene-2-carboxamide.
| Compound Name | N-(6-methyl-1,3-benzothiazol-2-yl)-N-(3-morpholin-4-ylpropyl)-5-nitro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 29070314 |
| Molecular Formula | C24H24N4O4S2 |
| Molecular Weight | 496.61 g/mol |
| Exact Mass | 496.12 |
| IUPAC Name | N-(6-methyl-1,3-benzothiazol-2-yl)-N-(3-morpholin-4-ylpropyl)-5-nitro-1-benzothiophene-2-carboxamide |
| SMILES | Cc1ccc2nc(N(CCCN3CCOCC3)C(=O)c3cc4cc([N+](=O)[O-])ccc4s3)sc2c1 |
| InChI | InChI=1S/C24H24N4O4S2/c1-16-3-5-19-21(13-16)34-24(25-19)27(8-2-7-26-9-11-32-12-10-26)23(29)22-15-17-14-18(28(30)31)4-6-20(17)33-22/h3-6,13-15H,2,7-12H2,1H3 |
| InChIKey | IYEIKFOEDAVATB-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 88.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.61 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|