C21H24N4O4S2 — CID 29073781
N-(5,6-dimethyl-1,3-benzothiazol-2-yl)-N-(3-morpholin-4-ylpropyl)-5-nitrothiophene-2-carboxamide (PubChem CID 29073781) has the molecular formula C21H24N4O4S2 and a molecular weight of 460.58 g/mol. Its IUPAC name is N-(5,6-dimethyl-1,3-benzothiazol-2-yl)-N-(3-morpholin-4-ylpropyl)-5-nitrothiophene-2-carboxamide.
| Compound Name | N-(5,6-dimethyl-1,3-benzothiazol-2-yl)-N-(3-morpholin-4-ylpropyl)-5-nitrothiophene-2-carboxamide |
|---|---|
| PubChem CID | 29073781 |
| Molecular Formula | C21H24N4O4S2 |
| Molecular Weight | 460.58 g/mol |
| Exact Mass | 460.12 |
| IUPAC Name | N-(5,6-dimethyl-1,3-benzothiazol-2-yl)-N-(3-morpholin-4-ylpropyl)-5-nitrothiophene-2-carboxamide |
| SMILES | Cc1cc2nc(N(CCCN3CCOCC3)C(=O)c3ccc([N+](=O)[O-])s3)sc2cc1C |
| InChI | InChI=1S/C21H24N4O4S2/c1-14-12-16-18(13-15(14)2)31-21(22-16)24(7-3-6-23-8-10-29-11-9-23)20(26)17-4-5-19(30-17)25(27)28/h4-5,12-13H,3,6-11H2,1-2H3 |
| InChIKey | NICGGHMRWODGHF-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 88.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.58 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|