C20H23ClN4O6S2 — CID 18583405
N-(4,7-dimethoxy-1,3-benzothiazol-2-yl)-N-(2-morpholin-4-ylethyl)-5-nitrothiophene-2-carboxamide;hydrochloride (PubChem CID 18583405) has the molecular formula C20H23ClN4O6S2 and a molecular weight of 515.01 g/mol. Its IUPAC name is N-(4,7-dimethoxy-1,3-benzothiazol-2-yl)-N-(2-morpholin-4-ylethyl)-5-nitrothiophene-2-carboxamide;hydrochloride.
| Compound Name | N-(4,7-dimethoxy-1,3-benzothiazol-2-yl)-N-(2-morpholin-4-ylethyl)-5-nitrothiophene-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 18583405 |
| Molecular Formula | C20H23ClN4O6S2 |
| Molecular Weight | 515.01 g/mol |
| Exact Mass | 514.07 |
| IUPAC Name | N-(4,7-dimethoxy-1,3-benzothiazol-2-yl)-N-(2-morpholin-4-ylethyl)-5-nitrothiophene-2-carboxamide;hydrochloride |
| SMILES | COc1ccc(OC)c2sc(N(CCN3CCOCC3)C(=O)c3ccc([N+](=O)[O-])s3)nc12.Cl |
| InChI | InChI=1S/C20H22N4O6S2.ClH/c1-28-13-3-4-14(29-2)18-17(13)21-20(32-18)23(8-7-22-9-11-30-12-10-22)19(25)15-5-6-16(31-15)24(26)27;/h3-6H,7-12H2,1-2H3;1H |
| InChIKey | JRFKMPNTJXRBFM-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 107.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.01 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|