C22H23ClN4O5S — CID 43997717
N-(7-chloro-4-methoxy-1,3-benzothiazol-2-yl)-N-(2-morpholin-4-ylethyl)-2-(4-nitrophenyl)acetamide (PubChem CID 43997717) has the molecular formula C22H23ClN4O5S and a molecular weight of 490.97 g/mol. Its IUPAC name is N-(7-chloro-4-methoxy-1,3-benzothiazol-2-yl)-N-(2-morpholin-4-ylethyl)-2-(4-nitrophenyl)acetamide.
| Compound Name | N-(7-chloro-4-methoxy-1,3-benzothiazol-2-yl)-N-(2-morpholin-4-ylethyl)-2-(4-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 43997717 |
| Molecular Formula | C22H23ClN4O5S |
| Molecular Weight | 490.97 g/mol |
| Exact Mass | 490.11 |
| IUPAC Name | N-(7-chloro-4-methoxy-1,3-benzothiazol-2-yl)-N-(2-morpholin-4-ylethyl)-2-(4-nitrophenyl)acetamide |
| SMILES | COc1ccc(Cl)c2sc(N(CCN3CCOCC3)C(=O)Cc3ccc([N+](=O)[O-])cc3)nc12 |
| InChI | InChI=1S/C22H23ClN4O5S/c1-31-18-7-6-17(23)21-20(18)24-22(33-21)26(9-8-25-10-12-32-13-11-25)19(28)14-15-2-4-16(5-3-15)27(29)30/h2-7H,8-14H2,1H3 |
| InChIKey | LRWGYRITJWTTPE-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 98.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.97 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|