C22H23ClN4O4S — CID 29073169
N-(7-chloro-4-methyl-1,3-benzothiazol-2-yl)-N-(3-morpholin-4-ylpropyl)-4-nitrobenzamide (PubChem CID 29073169) has the molecular formula C22H23ClN4O4S and a molecular weight of 474.97 g/mol. Its IUPAC name is N-(7-chloro-4-methyl-1,3-benzothiazol-2-yl)-N-(3-morpholin-4-ylpropyl)-4-nitrobenzamide.
| Compound Name | N-(7-chloro-4-methyl-1,3-benzothiazol-2-yl)-N-(3-morpholin-4-ylpropyl)-4-nitrobenzamide |
|---|---|
| PubChem CID | 29073169 |
| Molecular Formula | C22H23ClN4O4S |
| Molecular Weight | 474.97 g/mol |
| Exact Mass | 474.11 |
| IUPAC Name | N-(7-chloro-4-methyl-1,3-benzothiazol-2-yl)-N-(3-morpholin-4-ylpropyl)-4-nitrobenzamide |
| SMILES | Cc1ccc(Cl)c2sc(N(CCCN3CCOCC3)C(=O)c3ccc([N+](=O)[O-])cc3)nc12 |
| InChI | InChI=1S/C22H23ClN4O4S/c1-15-3-8-18(23)20-19(15)24-22(32-20)26(10-2-9-25-11-13-31-14-12-25)21(28)16-4-6-17(7-5-16)27(29)30/h3-8H,2,9-14H2,1H3 |
| InChIKey | AHHCSLKLOYTOAY-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 88.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.97 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|