C20H15N3O4S2 — CID 41110211
N-benzyl-N-(6-methoxy-1,3-benzothiazol-2-yl)-5-nitrothiophene-2-carboxamide (PubChem CID 41110211) has the molecular formula C20H15N3O4S2 and a molecular weight of 425.49 g/mol. Its IUPAC name is N-benzyl-N-(6-methoxy-1,3-benzothiazol-2-yl)-5-nitrothiophene-2-carboxamide.
| Compound Name | N-benzyl-N-(6-methoxy-1,3-benzothiazol-2-yl)-5-nitrothiophene-2-carboxamide |
|---|---|
| PubChem CID | 41110211 |
| Molecular Formula | C20H15N3O4S2 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.05 |
| IUPAC Name | N-benzyl-N-(6-methoxy-1,3-benzothiazol-2-yl)-5-nitrothiophene-2-carboxamide |
| SMILES | COc1ccc2nc(N(Cc3ccccc3)C(=O)c3ccc([N+](=O)[O-])s3)sc2c1 |
| InChI | InChI=1S/C20H15N3O4S2/c1-27-14-7-8-15-17(11-14)29-20(21-15)22(12-13-5-3-2-4-6-13)19(24)16-9-10-18(28-16)23(25)26/h2-11H,12H2,1H3 |
| InChIKey | JIBMIFMYRHLSPL-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 85.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|