C19H14N4O3S2 — CID 40508112
N-(6-methyl-1,3-benzothiazol-2-yl)-5-nitro-N-(pyridin-3-ylmethyl)thiophene-2-carboxamide (PubChem CID 40508112) has the molecular formula C19H14N4O3S2 and a molecular weight of 410.48 g/mol. Its IUPAC name is N-(6-methyl-1,3-benzothiazol-2-yl)-5-nitro-N-(pyridin-3-ylmethyl)thiophene-2-carboxamide.
| Compound Name | N-(6-methyl-1,3-benzothiazol-2-yl)-5-nitro-N-(pyridin-3-ylmethyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 40508112 |
| Molecular Formula | C19H14N4O3S2 |
| Molecular Weight | 410.48 g/mol |
| Exact Mass | 410.05 |
| IUPAC Name | N-(6-methyl-1,3-benzothiazol-2-yl)-5-nitro-N-(pyridin-3-ylmethyl)thiophene-2-carboxamide |
| SMILES | Cc1ccc2nc(N(Cc3cccnc3)C(=O)c3ccc([N+](=O)[O-])s3)sc2c1 |
| InChI | InChI=1S/C19H14N4O3S2/c1-12-4-5-14-16(9-12)28-19(21-14)22(11-13-3-2-8-20-10-13)18(24)15-6-7-17(27-15)23(25)26/h2-10H,11H2,1H3 |
| InChIKey | DDEMPPCCEPSRSL-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 89.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.48 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|