C22H17ClN4O3S — CID 40983291
2-chloro-N-(6-ethyl-1,3-benzothiazol-2-yl)-5-nitro-N-(pyridin-3-ylmethyl)benzamide (PubChem CID 40983291) has the molecular formula C22H17ClN4O3S and a molecular weight of 452.92 g/mol. Its IUPAC name is 2-chloro-N-(6-ethyl-1,3-benzothiazol-2-yl)-5-nitro-N-(pyridin-3-ylmethyl)benzamide.
| Compound Name | 2-chloro-N-(6-ethyl-1,3-benzothiazol-2-yl)-5-nitro-N-(pyridin-3-ylmethyl)benzamide |
|---|---|
| PubChem CID | 40983291 |
| Molecular Formula | C22H17ClN4O3S |
| Molecular Weight | 452.92 g/mol |
| Exact Mass | 452.07 |
| IUPAC Name | 2-chloro-N-(6-ethyl-1,3-benzothiazol-2-yl)-5-nitro-N-(pyridin-3-ylmethyl)benzamide |
| SMILES | CCc1ccc2nc(N(Cc3cccnc3)C(=O)c3cc([N+](=O)[O-])ccc3Cl)sc2c1 |
| InChI | InChI=1S/C22H17ClN4O3S/c1-2-14-5-8-19-20(10-14)31-22(25-19)26(13-15-4-3-9-24-12-15)21(28)17-11-16(27(29)30)6-7-18(17)23/h3-12H,2,13H2,1H3 |
| InChIKey | JZWNGYVBXKVRRL-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 89.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.92 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|