C27H35N5O4S — CID 43961891
N-[2-(diethylamino)ethyl]-N-(6-ethoxy-1,3-benzothiazol-2-yl)-3-nitro-4-piperidin-1-ylbenzamide (PubChem CID 43961891) has the molecular formula C27H35N5O4S and a molecular weight of 525.68 g/mol. Its IUPAC name is N-[2-(diethylamino)ethyl]-N-(6-ethoxy-1,3-benzothiazol-2-yl)-3-nitro-4-piperidin-1-ylbenzamide.
| Compound Name | N-[2-(diethylamino)ethyl]-N-(6-ethoxy-1,3-benzothiazol-2-yl)-3-nitro-4-piperidin-1-ylbenzamide |
|---|---|
| PubChem CID | 43961891 |
| Molecular Formula | C27H35N5O4S |
| Molecular Weight | 525.68 g/mol |
| Exact Mass | 525.24 |
| IUPAC Name | N-[2-(diethylamino)ethyl]-N-(6-ethoxy-1,3-benzothiazol-2-yl)-3-nitro-4-piperidin-1-ylbenzamide |
| SMILES | CCOc1ccc2nc(N(CCN(CC)CC)C(=O)c3ccc(N4CCCCC4)c([N+](=O)[O-])c3)sc2c1 |
| InChI | InChI=1S/C27H35N5O4S/c1-4-29(5-2)16-17-31(27-28-22-12-11-21(36-6-3)19-25(22)37-27)26(33)20-10-13-23(24(18-20)32(34)35)30-14-8-7-9-15-30/h10-13,18-19H,4-9,14-17H2,1-3H3 |
| InChIKey | OQYRLRBRCMHHOL-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 92.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.68 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|