C23H27N5O3S — CID 43961755
N-(1,3-benzothiazol-2-yl)-N-[2-(dimethylamino)ethyl]-3-nitro-4-piperidin-1-ylbenzamide (PubChem CID 43961755) has the molecular formula C23H27N5O3S and a molecular weight of 453.57 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-N-[2-(dimethylamino)ethyl]-3-nitro-4-piperidin-1-ylbenzamide.
| Compound Name | N-(1,3-benzothiazol-2-yl)-N-[2-(dimethylamino)ethyl]-3-nitro-4-piperidin-1-ylbenzamide |
|---|---|
| PubChem CID | 43961755 |
| Molecular Formula | C23H27N5O3S |
| Molecular Weight | 453.57 g/mol |
| Exact Mass | 453.18 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-N-[2-(dimethylamino)ethyl]-3-nitro-4-piperidin-1-ylbenzamide |
| SMILES | CN(C)CCN(C(=O)c1ccc(N2CCCCC2)c([N+](=O)[O-])c1)c1nc2ccccc2s1 |
| InChI | InChI=1S/C23H27N5O3S/c1-25(2)14-15-27(23-24-18-8-4-5-9-21(18)32-23)22(29)17-10-11-19(20(16-17)28(30)31)26-12-6-3-7-13-26/h4-5,8-11,16H,3,6-7,12-15H2,1-2H3 |
| InChIKey | ZRUZDNHEKBSGMF-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 82.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.57 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|