C26H25N5O3S — CID 43987196
N-(4-methyl-1,3-benzothiazol-2-yl)-3-nitro-4-piperidin-1-yl-N-(pyridin-2-ylmethyl)benzamide (PubChem CID 43987196) has the molecular formula C26H25N5O3S and a molecular weight of 487.59 g/mol. Its IUPAC name is N-(4-methyl-1,3-benzothiazol-2-yl)-3-nitro-4-piperidin-1-yl-N-(pyridin-2-ylmethyl)benzamide.
| Compound Name | N-(4-methyl-1,3-benzothiazol-2-yl)-3-nitro-4-piperidin-1-yl-N-(pyridin-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 43987196 |
| Molecular Formula | C26H25N5O3S |
| Molecular Weight | 487.59 g/mol |
| Exact Mass | 487.17 |
| IUPAC Name | N-(4-methyl-1,3-benzothiazol-2-yl)-3-nitro-4-piperidin-1-yl-N-(pyridin-2-ylmethyl)benzamide |
| SMILES | Cc1cccc2sc(N(Cc3ccccn3)C(=O)c3ccc(N4CCCCC4)c([N+](=O)[O-])c3)nc12 |
| InChI | InChI=1S/C26H25N5O3S/c1-18-8-7-10-23-24(18)28-26(35-23)30(17-20-9-3-4-13-27-20)25(32)19-11-12-21(22(16-19)31(33)34)29-14-5-2-6-15-29/h3-4,7-13,16H,2,5-6,14-15,17H2,1H3 |
| InChIKey | LPOGJGDUBFZVPC-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 92.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.59 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|