C22H24F2N4O5S — CID 43961611
N-[2-(diethylamino)ethyl]-N-(4,6-difluoro-1,3-benzothiazol-2-yl)-4,5-dimethoxy-2-nitrobenzamide (PubChem CID 43961611) has the molecular formula C22H24F2N4O5S and a molecular weight of 494.52 g/mol. Its IUPAC name is N-[2-(diethylamino)ethyl]-N-(4,6-difluoro-1,3-benzothiazol-2-yl)-4,5-dimethoxy-2-nitrobenzamide.
| Compound Name | N-[2-(diethylamino)ethyl]-N-(4,6-difluoro-1,3-benzothiazol-2-yl)-4,5-dimethoxy-2-nitrobenzamide |
|---|---|
| PubChem CID | 43961611 |
| Molecular Formula | C22H24F2N4O5S |
| Molecular Weight | 494.52 g/mol |
| Exact Mass | 494.14 |
| IUPAC Name | N-[2-(diethylamino)ethyl]-N-(4,6-difluoro-1,3-benzothiazol-2-yl)-4,5-dimethoxy-2-nitrobenzamide |
| SMILES | CCN(CC)CCN(C(=O)c1cc(OC)c(OC)cc1[N+](=O)[O-])c1nc2c(F)cc(F)cc2s1 |
| InChI | InChI=1S/C22H24F2N4O5S/c1-5-26(6-2)7-8-27(22-25-20-15(24)9-13(23)10-19(20)34-22)21(29)14-11-17(32-3)18(33-4)12-16(14)28(30)31/h9-12H,5-8H2,1-4H3 |
| InChIKey | QZPPOHKANKRONQ-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 98.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.52 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|