C22H25ClN4O5S — CID 41346658
5-chloro-N-[2-(diethylamino)ethyl]-N-(4,7-dimethoxy-1,3-benzothiazol-2-yl)-2-nitrobenzamide (PubChem CID 41346658) has the molecular formula C22H25ClN4O5S and a molecular weight of 492.99 g/mol. Its IUPAC name is 5-chloro-N-[2-(diethylamino)ethyl]-N-(4,7-dimethoxy-1,3-benzothiazol-2-yl)-2-nitrobenzamide.
| Compound Name | 5-chloro-N-[2-(diethylamino)ethyl]-N-(4,7-dimethoxy-1,3-benzothiazol-2-yl)-2-nitrobenzamide |
|---|---|
| PubChem CID | 41346658 |
| Molecular Formula | C22H25ClN4O5S |
| Molecular Weight | 492.99 g/mol |
| Exact Mass | 492.12 |
| IUPAC Name | 5-chloro-N-[2-(diethylamino)ethyl]-N-(4,7-dimethoxy-1,3-benzothiazol-2-yl)-2-nitrobenzamide |
| SMILES | CCN(CC)CCN(C(=O)c1cc(Cl)ccc1[N+](=O)[O-])c1nc2c(OC)ccc(OC)c2s1 |
| InChI | InChI=1S/C22H25ClN4O5S/c1-5-25(6-2)11-12-26(21(28)15-13-14(23)7-8-16(15)27(29)30)22-24-19-17(31-3)9-10-18(32-4)20(19)33-22/h7-10,13H,5-6,11-12H2,1-4H3 |
| InChIKey | FTBGRJVMMWBCOC-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 98.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.99 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|